C14H16O5S — CID 82165396
4-[4-(3-carboxypropylsulfanyl)phenyl]-4-oxobutanoic acid (PubChem CID 82165396) has the molecular formula C14H16O5S and a molecular weight of 296.34 g/mol. Its IUPAC name is 4-[4-(3-carboxypropylsulfanyl)phenyl]-4-oxobutanoic acid.
| Compound Name | 4-[4-(3-carboxypropylsulfanyl)phenyl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 82165396 |
| Molecular Formula | C14H16O5S |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 4-[4-(3-carboxypropylsulfanyl)phenyl]-4-oxobutanoic acid |
| SMILES | O=C(O)CCCSc1ccc(C(=O)CCC(=O)O)cc1 |
| InChI | InChI=1S/C14H16O5S/c15-12(7-8-14(18)19)10-3-5-11(6-4-10)20-9-1-2-13(16)17/h3-6H,1-2,7-9H2,(H,16,17)(H,18,19) |
| InChIKey | LAKQWKFROMOVSK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|