C15H11Cl6N3O2S — CID 175602786
4-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]sulfanylbutanoic acid (PubChem CID 175602786) has the molecular formula C15H11Cl6N3O2S and a molecular weight of 510.06 g/mol. Its IUPAC name is 4-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]sulfanylbutanoic acid.
| Compound Name | 4-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 175602786 |
| Molecular Formula | C15H11Cl6N3O2S |
| Molecular Weight | 510.06 g/mol |
| Exact Mass | 506.87 |
| IUPAC Name | 4-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]sulfanylbutanoic acid |
| SMILES | O=C(O)CCCSc1ccc(-c2nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n2)cc1 |
| InChI | InChI=1S/C15H11Cl6N3O2S/c16-14(17,18)12-22-11(23-13(24-12)15(19,20)21)8-3-5-9(6-4-8)27-7-1-2-10(25)26/h3-6H,1-2,7H2,(H,25,26) |
| InChIKey | OIIJZFVANUTRCP-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.06 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|