C13H18O3S — CID 24797502
6-(4-methoxyphenyl)sulfanylhexanoic acid (PubChem CID 24797502) has the molecular formula C13H18O3S and a molecular weight of 254.35 g/mol. Its IUPAC name is 6-(4-methoxyphenyl)sulfanylhexanoic acid.
| Compound Name | 6-(4-methoxyphenyl)sulfanylhexanoic acid |
|---|---|
| PubChem CID | 24797502 |
| Molecular Formula | C13H18O3S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | 6-(4-methoxyphenyl)sulfanylhexanoic acid |
| SMILES | COc1ccc(SCCCCCC(=O)O)cc1 |
| InChI | InChI=1S/C13H18O3S/c1-16-11-6-8-12(9-7-11)17-10-4-2-3-5-13(14)15/h6-9H,2-5,10H2,1H3,(H,14,15) |
| InChIKey | CSEJQDKFRRVFPS-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|