C24H32O4S2 — CID 158882439
4-methoxy-6-phenylsulfanylhexan-2-one;5-phenylsulfanylpentanoic acid (PubChem CID 158882439) has the molecular formula C24H32O4S2 and a molecular weight of 448.65 g/mol. Its IUPAC name is 4-methoxy-6-phenylsulfanylhexan-2-one;5-phenylsulfanylpentanoic acid.
| Compound Name | 4-methoxy-6-phenylsulfanylhexan-2-one;5-phenylsulfanylpentanoic acid |
|---|---|
| PubChem CID | 158882439 |
| Molecular Formula | C24H32O4S2 |
| Molecular Weight | 448.65 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 4-methoxy-6-phenylsulfanylhexan-2-one;5-phenylsulfanylpentanoic acid |
| SMILES | COC(CCSc1ccccc1)CC(C)=O.O=C(O)CCCCSc1ccccc1 |
| InChI | InChI=1S/C13H18O2S.C11H14O2S/c1-11(14)10-12(15-2)8-9-16-13-6-4-3-5-7-13;12-11(13)8-4-5-9-14-10-6-2-1-3-7-10/h3-7,12H,8-10H2,1-2H3;1-3,6-7H,4-5,8-9H2,(H,12,13) |
| InChIKey | JDEQOBHXEQTVDN-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.65 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|