C25H27NO2S — CID 41086505
N,N-dibenzyl-4-(4-methoxyphenyl)sulfanylbutanamide (PubChem CID 41086505) has the molecular formula C25H27NO2S and a molecular weight of 405.56 g/mol. Its IUPAC name is N,N-dibenzyl-4-(4-methoxyphenyl)sulfanylbutanamide.
| Compound Name | N,N-dibenzyl-4-(4-methoxyphenyl)sulfanylbutanamide |
|---|---|
| PubChem CID | 41086505 |
| Molecular Formula | C25H27NO2S |
| Molecular Weight | 405.56 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | N,N-dibenzyl-4-(4-methoxyphenyl)sulfanylbutanamide |
| SMILES | COc1ccc(SCCCC(=O)N(Cc2ccccc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C25H27NO2S/c1-28-23-14-16-24(17-15-23)29-18-8-13-25(27)26(19-21-9-4-2-5-10-21)20-22-11-6-3-7-12-22/h2-7,9-12,14-17H,8,13,18-20H2,1H3 |
| InChIKey | WTIUEAQYUSUKKB-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.56 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|