C14H9Cl6N3O2S — CID 162172105
2-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]sulfanylpropanoic acid (PubChem CID 162172105) has the molecular formula C14H9Cl6N3O2S and a molecular weight of 496.03 g/mol. Its IUPAC name is 2-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]sulfanylpropanoic acid.
| Compound Name | 2-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 162172105 |
| Molecular Formula | C14H9Cl6N3O2S |
| Molecular Weight | 496.03 g/mol |
| Exact Mass | 492.85 |
| IUPAC Name | 2-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]sulfanylpropanoic acid |
| SMILES | CC(Sc1ccc(-c2nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n2)cc1)C(=O)O |
| InChI | InChI=1S/C14H9Cl6N3O2S/c1-6(10(24)25)26-8-4-2-7(3-5-8)9-21-11(13(15,16)17)23-12(22-9)14(18,19)20/h2-6H,1H3,(H,24,25) |
| InChIKey | ZNXURZIMHLXLDP-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.03 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|