C13H10Cl3N3O — CID 58875675
1-[4-[4-methyl-6-(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]ethanone (PubChem CID 58875675) has the molecular formula C13H10Cl3N3O and a molecular weight of 330.60 g/mol. Its IUPAC name is 1-[4-[4-methyl-6-(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]ethanone.
| Compound Name | 1-[4-[4-methyl-6-(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 58875675 |
| Molecular Formula | C13H10Cl3N3O |
| Molecular Weight | 330.60 g/mol |
| Exact Mass | 328.99 |
| IUPAC Name | 1-[4-[4-methyl-6-(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(-c2nc(C)nc(C(Cl)(Cl)Cl)n2)cc1 |
| InChI | InChI=1S/C13H10Cl3N3O/c1-7(20)9-3-5-10(6-4-9)11-17-8(2)18-12(19-11)13(14,15)16/h3-6H,1-2H3 |
| InChIKey | VYCMMCZEGJEYTB-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.60 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|