C14H9Cl7N4O — CID 15001923
N-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]-3-chloropropanamide (PubChem CID 15001923) has the molecular formula C14H9Cl7N4O and a molecular weight of 497.42 g/mol. Its IUPAC name is N-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]-3-chloropropanamide.
| Compound Name | N-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]-3-chloropropanamide |
|---|---|
| PubChem CID | 15001923 |
| Molecular Formula | C14H9Cl7N4O |
| Molecular Weight | 497.42 g/mol |
| Exact Mass | 493.86 |
| IUPAC Name | N-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]-3-chloropropanamide |
| SMILES | O=C(CCCl)Nc1ccc(-c2nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n2)cc1 |
| InChI | InChI=1S/C14H9Cl7N4O/c15-6-5-9(26)22-8-3-1-7(2-4-8)10-23-11(13(16,17)18)25-12(24-10)14(19,20)21/h1-4H,5-6H2,(H,22,26) |
| InChIKey | LOOFFOIYVCUEED-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.42 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|