C17H10Cl6N4 — CID 89384064
4-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]aniline (PubChem CID 89384064) has the molecular formula C17H10Cl6N4 and a molecular weight of 483.01 g/mol. Its IUPAC name is 4-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]aniline.
| Compound Name | 4-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]aniline |
|---|---|
| PubChem CID | 89384064 |
| Molecular Formula | C17H10Cl6N4 |
| Molecular Weight | 483.01 g/mol |
| Exact Mass | 479.90 |
| IUPAC Name | 4-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]aniline |
| SMILES | Nc1ccc(-c2ccc(-c3nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n3)cc2)cc1 |
| InChI | InChI=1S/C17H10Cl6N4/c18-16(19,20)14-25-13(26-15(27-14)17(21,22)23)11-3-1-9(2-4-11)10-5-7-12(24)8-6-10/h1-8H,24H2 |
| InChIKey | ZDJVVSUQWPTWGZ-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.01 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|