C14H7Cl6N3O2 — CID 14572917
(E)-3-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]prop-2-enoic acid (PubChem CID 14572917) has the molecular formula C14H7Cl6N3O2 and a molecular weight of 461.95 g/mol. Its IUPAC name is (E)-3-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 14572917 |
| Molecular Formula | C14H7Cl6N3O2 |
| Molecular Weight | 461.95 g/mol |
| Exact Mass | 458.87 |
| IUPAC Name | (E)-3-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(-c2nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n2)cc1 |
| InChI | InChI=1S/C14H7Cl6N3O2/c15-13(16,17)11-21-10(22-12(23-11)14(18,19)20)8-4-1-7(2-5-8)3-6-9(24)25/h1-6H,(H,24,25)/b6-3+ |
| InChIKey | BNCUODWPUJZLIW-ZZXKWVIFSA-N |
| XLogP | 5.29 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.95 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|