C39H25Cl13N6 — CID 158786796
chloromethane;bis(2-[4-(2-phenylethenyl)phenyl]-4,6-bis(trichloromethyl)-1,3,5-triazine) (PubChem CID 158786796) has the molecular formula C39H25Cl13N6 and a molecular weight of 1038.56 g/mol. Its IUPAC name is chloromethane;bis(2-[4-(2-phenylethenyl)phenyl]-4,6-bis(trichloromethyl)-1,3,5-triazine).
| Compound Name | chloromethane;bis(2-[4-(2-phenylethenyl)phenyl]-4,6-bis(trichloromethyl)-1,3,5-triazine) |
|---|---|
| PubChem CID | 158786796 |
| Molecular Formula | C39H25Cl13N6 |
| Molecular Weight | 1038.56 g/mol |
| Exact Mass | 1031.81 |
| IUPAC Name | chloromethane;bis(2-[4-(2-phenylethenyl)phenyl]-4,6-bis(trichloromethyl)-1,3,5-triazine) |
| SMILES | CCl.ClC(Cl)(Cl)c1nc(-c2ccc(C=Cc3ccccc3)cc2)nc(C(Cl)(Cl)Cl)n1.ClC(Cl)(Cl)c1nc(-c2ccc(C=Cc3ccccc3)cc2)nc(C(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/2C19H11Cl6N3.CH3Cl/c2*20-18(21,22)16-26-15(27-17(28-16)19(23,24)25)14-10-8-13(9-11-14)7-6-12-4-2-1-3-5-12;1-2/h2*1-11H;1H3 |
| InChIKey | IRTZGFVLMCYCGS-UHFFFAOYSA-N |
| XLogP | 15.58 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1038.56 |
| LogP ≤ 5 | 15.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|