C10H6Cl3N3 — CID 18985813
2-phenyl-4-(trichloromethyl)-1,3,5-triazine (PubChem CID 18985813) has the molecular formula C10H6Cl3N3 and a molecular weight of 274.54 g/mol. Its IUPAC name is 2-phenyl-4-(trichloromethyl)-1,3,5-triazine.
| Compound Name | 2-phenyl-4-(trichloromethyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 18985813 |
| Molecular Formula | C10H6Cl3N3 |
| Molecular Weight | 274.54 g/mol |
| Exact Mass | 272.96 |
| IUPAC Name | 2-phenyl-4-(trichloromethyl)-1,3,5-triazine |
| SMILES | ClC(Cl)(Cl)c1ncnc(-c2ccccc2)n1 |
| InChI | InChI=1S/C10H6Cl3N3/c11-10(12,13)9-15-6-14-8(16-9)7-4-2-1-3-5-7/h1-6H |
| InChIKey | ZAUJDNGIUSWSNE-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.54 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|