C19H12Cl3N3O — CID 172779080
2-[4-[2-(4-methoxyphenyl)ethynyl]phenyl]-4-(trichloromethyl)-1,3,5-triazine (PubChem CID 172779080) has the molecular formula C19H12Cl3N3O and a molecular weight of 404.68 g/mol. Its IUPAC name is 2-[4-[2-(4-methoxyphenyl)ethynyl]phenyl]-4-(trichloromethyl)-1,3,5-triazine.
| Compound Name | 2-[4-[2-(4-methoxyphenyl)ethynyl]phenyl]-4-(trichloromethyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 172779080 |
| Molecular Formula | C19H12Cl3N3O |
| Molecular Weight | 404.68 g/mol |
| Exact Mass | 403.00 |
| IUPAC Name | 2-[4-[2-(4-methoxyphenyl)ethynyl]phenyl]-4-(trichloromethyl)-1,3,5-triazine |
| SMILES | COc1ccc(C#Cc2ccc(-c3ncnc(C(Cl)(Cl)Cl)n3)cc2)cc1 |
| InChI | InChI=1S/C19H12Cl3N3O/c1-26-16-10-6-14(7-11-16)3-2-13-4-8-15(9-5-13)17-23-12-24-18(25-17)19(20,21)22/h4-12H,1H3 |
| InChIKey | NZXAJMMMZHTVBO-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.68 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|