C16H18Cl3N5O — CID 118250333
1-[4-(4-methoxyphenyl)-6-(trichloromethyl)-1,3,5-triazin-2-yl]-1,4-diazepane (PubChem CID 118250333) has the molecular formula C16H18Cl3N5O and a molecular weight of 402.71 g/mol. Its IUPAC name is 1-[4-(4-methoxyphenyl)-6-(trichloromethyl)-1,3,5-triazin-2-yl]-1,4-diazepane.
| Compound Name | 1-[4-(4-methoxyphenyl)-6-(trichloromethyl)-1,3,5-triazin-2-yl]-1,4-diazepane |
|---|---|
| PubChem CID | 118250333 |
| Molecular Formula | C16H18Cl3N5O |
| Molecular Weight | 402.71 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | 1-[4-(4-methoxyphenyl)-6-(trichloromethyl)-1,3,5-triazin-2-yl]-1,4-diazepane |
| SMILES | COc1ccc(-c2nc(N3CCCNCC3)nc(C(Cl)(Cl)Cl)n2)cc1 |
| InChI | InChI=1S/C16H18Cl3N5O/c1-25-12-5-3-11(4-6-12)13-21-14(16(17,18)19)23-15(22-13)24-9-2-7-20-8-10-24/h3-6,20H,2,7-10H2,1H3 |
| InChIKey | APUVRCPLFPYUEU-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.71 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|