C15H16Cl3N5 — CID 118250258
2-(4-methylpiperazin-1-yl)-4-phenyl-6-(trichloromethyl)-1,3,5-triazine (PubChem CID 118250258) has the molecular formula C15H16Cl3N5 and a molecular weight of 372.69 g/mol. Its IUPAC name is 2-(4-methylpiperazin-1-yl)-4-phenyl-6-(trichloromethyl)-1,3,5-triazine.
| Compound Name | 2-(4-methylpiperazin-1-yl)-4-phenyl-6-(trichloromethyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 118250258 |
| Molecular Formula | C15H16Cl3N5 |
| Molecular Weight | 372.69 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | 2-(4-methylpiperazin-1-yl)-4-phenyl-6-(trichloromethyl)-1,3,5-triazine |
| SMILES | CN1CCN(c2nc(-c3ccccc3)nc(C(Cl)(Cl)Cl)n2)CC1 |
| InChI | InChI=1S/C15H16Cl3N5/c1-22-7-9-23(10-8-22)14-20-12(11-5-3-2-4-6-11)19-13(21-14)15(16,17)18/h2-6H,7-10H2,1H3 |
| InChIKey | PJZRHVHQWGRGOG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.69 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|