C18H22Cl3N5O2 — CID 118250354
1-[4-(3,4-dimethoxyphenyl)-6-(trichloromethyl)-1,3,5-triazin-2-yl]-4-methyl-1,4-diazepane (PubChem CID 118250354) has the molecular formula C18H22Cl3N5O2 and a molecular weight of 446.77 g/mol. Its IUPAC name is 1-[4-(3,4-dimethoxyphenyl)-6-(trichloromethyl)-1,3,5-triazin-2-yl]-4-methyl-1,4-diazepane.
| Compound Name | 1-[4-(3,4-dimethoxyphenyl)-6-(trichloromethyl)-1,3,5-triazin-2-yl]-4-methyl-1,4-diazepane |
|---|---|
| PubChem CID | 118250354 |
| Molecular Formula | C18H22Cl3N5O2 |
| Molecular Weight | 446.77 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | 1-[4-(3,4-dimethoxyphenyl)-6-(trichloromethyl)-1,3,5-triazin-2-yl]-4-methyl-1,4-diazepane |
| SMILES | COc1ccc(-c2nc(N3CCCN(C)CC3)nc(C(Cl)(Cl)Cl)n2)cc1OC |
| InChI | InChI=1S/C18H22Cl3N5O2/c1-25-7-4-8-26(10-9-25)17-23-15(22-16(24-17)18(19,20)21)12-5-6-13(27-2)14(11-12)28-3/h5-6,11H,4,7-10H2,1-3H3 |
| InChIKey | FSAKHJKXFSRBTJ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 63.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.77 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|