C16H9Cl6N3O — CID 175049139
2-(8-methoxynaphthalen-2-yl)-4,6-bis(trichloromethyl)-1,3,5-triazine (PubChem CID 175049139) has the molecular formula C16H9Cl6N3O and a molecular weight of 471.99 g/mol. Its IUPAC name is 2-(8-methoxynaphthalen-2-yl)-4,6-bis(trichloromethyl)-1,3,5-triazine.
| Compound Name | 2-(8-methoxynaphthalen-2-yl)-4,6-bis(trichloromethyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 175049139 |
| Molecular Formula | C16H9Cl6N3O |
| Molecular Weight | 471.99 g/mol |
| Exact Mass | 468.89 |
| IUPAC Name | 2-(8-methoxynaphthalen-2-yl)-4,6-bis(trichloromethyl)-1,3,5-triazine |
| SMILES | COc1cccc2ccc(-c3nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n3)cc12 |
| InChI | InChI=1S/C16H9Cl6N3O/c1-26-11-4-2-3-8-5-6-9(7-10(8)11)12-23-13(15(17,18)19)25-14(24-12)16(20,21)22/h2-7H,1H3 |
| InChIKey | MJLVEFKUTGVJHR-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.99 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|