C16H15Cl6N3O3 — CID 174947663
2-ethenyl-4,6-bis(trichloromethyl)-1,3,5-triazine;1,2,3-trimethoxybenzene (PubChem CID 174947663) has the molecular formula C16H15Cl6N3O3 and a molecular weight of 510.03 g/mol. Its IUPAC name is 2-ethenyl-4,6-bis(trichloromethyl)-1,3,5-triazine;1,2,3-trimethoxybenzene.
| Compound Name | 2-ethenyl-4,6-bis(trichloromethyl)-1,3,5-triazine;1,2,3-trimethoxybenzene |
|---|---|
| PubChem CID | 174947663 |
| Molecular Formula | C16H15Cl6N3O3 |
| Molecular Weight | 510.03 g/mol |
| Exact Mass | 506.92 |
| IUPAC Name | 2-ethenyl-4,6-bis(trichloromethyl)-1,3,5-triazine;1,2,3-trimethoxybenzene |
| SMILES | C=Cc1nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n1.COc1cccc(OC)c1OC |
| InChI | InChI=1S/C9H12O3.C7H3Cl6N3/c1-10-7-5-4-6-8(11-2)9(7)12-3;1-2-3-14-4(6(8,9)10)16-5(15-3)7(11,12)13/h4-6H,1-3H3;2H,1H2 |
| InChIKey | HMXMUALGUZVPPC-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 66.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.03 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|