C14H12Cl2O3 — CID 173291827
1,2-dichloro-3-(2,6-dimethoxyphenoxy)benzene (PubChem CID 173291827) has the molecular formula C14H12Cl2O3 and a molecular weight of 299.15 g/mol. Its IUPAC name is 1,2-dichloro-3-(2,6-dimethoxyphenoxy)benzene.
| Compound Name | 1,2-dichloro-3-(2,6-dimethoxyphenoxy)benzene |
|---|---|
| PubChem CID | 173291827 |
| Molecular Formula | C14H12Cl2O3 |
| Molecular Weight | 299.15 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | 1,2-dichloro-3-(2,6-dimethoxyphenoxy)benzene |
| SMILES | COc1cccc(OC)c1Oc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C14H12Cl2O3/c1-17-11-7-4-8-12(18-2)14(11)19-10-6-3-5-9(15)13(10)16/h3-8H,1-2H3 |
| InChIKey | ZNFDVJDVIJTOOD-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.15 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |