C16H9Cl3N2O3 — CID 122656820
3,4,6-trichloro-5-(2,6-dimethoxyphenoxy)benzene-1,2-dicarbonitrile (PubChem CID 122656820) has the molecular formula C16H9Cl3N2O3 and a molecular weight of 383.62 g/mol. Its IUPAC name is 3,4,6-trichloro-5-(2,6-dimethoxyphenoxy)benzene-1,2-dicarbonitrile.
| Compound Name | 3,4,6-trichloro-5-(2,6-dimethoxyphenoxy)benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 122656820 |
| Molecular Formula | C16H9Cl3N2O3 |
| Molecular Weight | 383.62 g/mol |
| Exact Mass | 381.97 |
| IUPAC Name | 3,4,6-trichloro-5-(2,6-dimethoxyphenoxy)benzene-1,2-dicarbonitrile |
| SMILES | COc1cccc(OC)c1Oc1c(Cl)c(Cl)c(C#N)c(C#N)c1Cl |
| InChI | InChI=1S/C16H9Cl3N2O3/c1-22-10-4-3-5-11(23-2)15(10)24-16-13(18)9(7-21)8(6-20)12(17)14(16)19/h3-5H,1-2H3 |
| InChIKey | YCOZMDJJLOTREI-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 75.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.62 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|