C15H9Cl3N4O2 — CID 171980747
5,7,8-trichloro-3-(2,3-dimethoxyphenyl)-[1,2,4]triazolo[4,3-a]pyridine-6-carbonitrile (PubChem CID 171980747) has the molecular formula C15H9Cl3N4O2 and a molecular weight of 383.62 g/mol. Its IUPAC name is 5,7,8-trichloro-3-(2,3-dimethoxyphenyl)-[1,2,4]triazolo[4,3-a]pyridine-6-carbonitrile.
| Compound Name | 5,7,8-trichloro-3-(2,3-dimethoxyphenyl)-[1,2,4]triazolo[4,3-a]pyridine-6-carbonitrile |
|---|---|
| PubChem CID | 171980747 |
| Molecular Formula | C15H9Cl3N4O2 |
| Molecular Weight | 383.62 g/mol |
| Exact Mass | 381.98 |
| IUPAC Name | 5,7,8-trichloro-3-(2,3-dimethoxyphenyl)-[1,2,4]triazolo[4,3-a]pyridine-6-carbonitrile |
| SMILES | COc1cccc(-c2nnc3c(Cl)c(Cl)c(C#N)c(Cl)n23)c1OC |
| InChI | InChI=1S/C15H9Cl3N4O2/c1-23-9-5-3-4-7(12(9)24-2)14-20-21-15-11(17)10(16)8(6-19)13(18)22(14)15/h3-5H,1-2H3 |
| InChIKey | HUBBWSMXKJMQHL-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 72.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.62 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|