C12H16N4O2 — CID 112596566
5-(2,3-dimethoxyphenyl)-N,4-dimethyl-1,2,4-triazol-3-amine (PubChem CID 112596566) has the molecular formula C12H16N4O2 and a molecular weight of 248.29 g/mol. Its IUPAC name is 5-(2,3-dimethoxyphenyl)-N,4-dimethyl-1,2,4-triazol-3-amine.
| Compound Name | 5-(2,3-dimethoxyphenyl)-N,4-dimethyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 112596566 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 5-(2,3-dimethoxyphenyl)-N,4-dimethyl-1,2,4-triazol-3-amine |
| SMILES | CNc1nnc(-c2cccc(OC)c2OC)n1C |
| InChI | InChI=1S/C12H16N4O2/c1-13-12-15-14-11(16(12)2)8-6-5-7-9(17-3)10(8)18-4/h5-7H,1-4H3,(H,13,15) |
| InChIKey | YVKXDSKUWKXRMB-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |