C12H15N3O2 — CID 113301247
3-(2,3-dimethoxyphenyl)-4-ethyl-1,2,4-triazole (PubChem CID 113301247) has the molecular formula C12H15N3O2 and a molecular weight of 233.27 g/mol. Its IUPAC name is 3-(2,3-dimethoxyphenyl)-4-ethyl-1,2,4-triazole.
| Compound Name | 3-(2,3-dimethoxyphenyl)-4-ethyl-1,2,4-triazole |
|---|---|
| PubChem CID | 113301247 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 3-(2,3-dimethoxyphenyl)-4-ethyl-1,2,4-triazole |
| SMILES | CCn1cnnc1-c1cccc(OC)c1OC |
| InChI | InChI=1S/C12H15N3O2/c1-4-15-8-13-14-12(15)9-6-5-7-10(16-2)11(9)17-3/h5-8H,4H2,1-3H3 |
| InChIKey | ILMNRLNXJISFSY-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |