C15H21N5O2 — CID 119733347
N-[2-(4-ethyl-1,2,4-triazol-3-yl)phenyl]-2-(2-methoxyethylamino)acetamide (PubChem CID 119733347) has the molecular formula C15H21N5O2 and a molecular weight of 303.37 g/mol. Its IUPAC name is N-[2-(4-ethyl-1,2,4-triazol-3-yl)phenyl]-2-(2-methoxyethylamino)acetamide.
| Compound Name | N-[2-(4-ethyl-1,2,4-triazol-3-yl)phenyl]-2-(2-methoxyethylamino)acetamide |
|---|---|
| PubChem CID | 119733347 |
| Molecular Formula | C15H21N5O2 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | N-[2-(4-ethyl-1,2,4-triazol-3-yl)phenyl]-2-(2-methoxyethylamino)acetamide |
| SMILES | CCn1cnnc1-c1ccccc1NC(=O)CNCCOC |
| InChI | InChI=1S/C15H21N5O2/c1-3-20-11-17-19-15(20)12-6-4-5-7-13(12)18-14(21)10-16-8-9-22-2/h4-7,11,16H,3,8-10H2,1-2H3,(H,18,21) |
| InChIKey | RQHFJFMCUCFODS-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|