C15H19N5O3 — CID 122079973
4-[[2-(4-ethyl-1,2,4-triazol-3-yl)phenyl]carbamoylamino]butanoic acid (PubChem CID 122079973) has the molecular formula C15H19N5O3 and a molecular weight of 317.35 g/mol. Its IUPAC name is 4-[[2-(4-ethyl-1,2,4-triazol-3-yl)phenyl]carbamoylamino]butanoic acid.
| Compound Name | 4-[[2-(4-ethyl-1,2,4-triazol-3-yl)phenyl]carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122079973 |
| Molecular Formula | C15H19N5O3 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | 4-[[2-(4-ethyl-1,2,4-triazol-3-yl)phenyl]carbamoylamino]butanoic acid |
| SMILES | CCn1cnnc1-c1ccccc1NC(=O)NCCCC(=O)O |
| InChI | InChI=1S/C15H19N5O3/c1-2-20-10-17-19-14(20)11-6-3-4-7-12(11)18-15(23)16-9-5-8-13(21)22/h3-4,6-7,10H,2,5,8-9H2,1H3,(H,21,22)(H2,16,18,23) |
| InChIKey | OQYODCYMIYKATL-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|