C15H21N5O — CID 120560664
4-amino-N-[2-(4-ethyl-1,2,4-triazol-3-yl)phenyl]pentanamide (PubChem CID 120560664) has the molecular formula C15H21N5O and a molecular weight of 287.37 g/mol. Its IUPAC name is 4-amino-N-[2-(4-ethyl-1,2,4-triazol-3-yl)phenyl]pentanamide.
| Compound Name | 4-amino-N-[2-(4-ethyl-1,2,4-triazol-3-yl)phenyl]pentanamide |
|---|---|
| PubChem CID | 120560664 |
| Molecular Formula | C15H21N5O |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 4-amino-N-[2-(4-ethyl-1,2,4-triazol-3-yl)phenyl]pentanamide |
| SMILES | CCn1cnnc1-c1ccccc1NC(=O)CCC(C)N |
| InChI | InChI=1S/C15H21N5O/c1-3-20-10-17-19-15(20)12-6-4-5-7-13(12)18-14(21)9-8-11(2)16/h4-7,10-11H,3,8-9,16H2,1-2H3,(H,18,21) |
| InChIKey | VIOYJVSEOCFIED-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |