C9H10N4O — CID 54284537
3-(2-methoxyphenyl)-1,2,4-triazol-4-amine (PubChem CID 54284537) has the molecular formula C9H10N4O and a molecular weight of 190.21 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)-1,2,4-triazol-4-amine.
| Compound Name | 3-(2-methoxyphenyl)-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 54284537 |
| Molecular Formula | C9H10N4O |
| Molecular Weight | 190.21 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | 3-(2-methoxyphenyl)-1,2,4-triazol-4-amine |
| SMILES | COc1ccccc1-c1nncn1N |
| InChI | InChI=1S/C9H10N4O/c1-14-8-5-3-2-4-7(8)9-12-11-6-13(9)10/h2-6H,10H2,1H3 |
| InChIKey | YMWIXBVRXVEMGX-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.21 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |