C13H8N2O — CID 169050362
2-methoxynaphthalene-1,4-dicarbonitrile (PubChem CID 169050362) has the molecular formula C13H8N2O and a molecular weight of 208.22 g/mol. Its IUPAC name is 2-methoxynaphthalene-1,4-dicarbonitrile.
| Compound Name | 2-methoxynaphthalene-1,4-dicarbonitrile |
|---|---|
| PubChem CID | 169050362 |
| Molecular Formula | C13H8N2O |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | 2-methoxynaphthalene-1,4-dicarbonitrile |
| SMILES | COc1cc(C#N)c2ccccc2c1C#N |
| InChI | InChI=1S/C13H8N2O/c1-16-13-6-9(7-14)10-4-2-3-5-11(10)12(13)8-15/h2-6H,1H3 |
| InChIKey | VZMLXCOMZANHTK-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |