C13H11NO2 — CID 177120866
2,3-dimethoxynaphthalene-1-carbonitrile (PubChem CID 177120866) has the molecular formula C13H11NO2 and a molecular weight of 212.24 g/mol. Its IUPAC name is 2,3-dimethoxynaphthalene-1-carbonitrile.
| Compound Name | 2,3-dimethoxynaphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 177120866 |
| Molecular Formula | C13H11NO2 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | 2,3-dimethoxynaphthalene-1-carbonitrile |
| SMILES | COc1cc2ccccc2c([11C]#N)c1OC |
| InChI | InChI=1S/C13H11NO2/c1-15-12-7-9-5-3-4-6-10(9)11(8-14)13(12)16-2/h3-7H,1-2H3/i8-1 |
| InChIKey | KAQBZTVFONGPRO-COJKEBBMSA-N |
| XLogP | 2.73 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |