C13H13NO3 — CID 22397383
(NE)-N-[(2,3-dimethoxynaphthalen-1-yl)methylidene]hydroxylamine (PubChem CID 22397383) has the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. Its IUPAC name is (NE)-N-[(2,3-dimethoxynaphthalen-1-yl)methylidene]hydroxylamine.
| Compound Name | (NE)-N-[(2,3-dimethoxynaphthalen-1-yl)methylidene]hydroxylamine |
|---|---|
| PubChem CID | 22397383 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | (NE)-N-[(2,3-dimethoxynaphthalen-1-yl)methylidene]hydroxylamine |
| SMILES | COc1cc2ccccc2c(/C=N/O)c1OC |
| InChI | InChI=1S/C13H13NO3/c1-16-12-7-9-5-3-4-6-10(9)11(8-14-15)13(12)17-2/h3-8,15H,1-2H3/b14-8+ |
| InChIKey | FSAXWSRACISGJN-RIYZIHGNSA-N |
| XLogP | 2.67 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|