C26H16N2O2 — CID 102125962
12,13-dimethoxypentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),2(11),3,5,7,9,12,15,17,19,21-undecaene-9,16-dicarbonitrile (PubChem CID 102125962) has the molecular formula C26H16N2O2 and a molecular weight of 388.43 g/mol. Its IUPAC name is 12,13-dimethoxypentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),2(11),3,5,7,9,12,15,17,19,21-undecaene-9,16-dicarbonitrile.
| Compound Name | 12,13-dimethoxypentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),2(11),3,5,7,9,12,15,17,19,21-undecaene-9,16-dicarbonitrile |
|---|---|
| PubChem CID | 102125962 |
| Molecular Formula | C26H16N2O2 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 12,13-dimethoxypentacyclo[12.8.0.02,11.03,8.017,22]docosa-1(14),2(11),3,5,7,9,12,15,17,19,21-undecaene-9,16-dicarbonitrile |
| SMILES | COc1c(OC)c2cc(C#N)c3ccccc3c2c2c1cc(C#N)c1ccccc12 |
| InChI | InChI=1S/C26H16N2O2/c1-29-25-21-11-15(13-27)17-7-3-5-9-19(17)23(21)24-20-10-6-4-8-18(20)16(14-28)12-22(24)26(25)30-2/h3-12H,1-2H3 |
| InChIKey | AHKAILYIYQZBDI-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|