C33H23N3O — CID 89242616
3-[2-[4-(N-(4-methoxyphenyl)anilino)phenyl]ethenyl]naphthalene-1,5-dicarbonitrile (PubChem CID 89242616) has the molecular formula C33H23N3O and a molecular weight of 477.57 g/mol. Its IUPAC name is 3-[2-[4-(N-(4-methoxyphenyl)anilino)phenyl]ethenyl]naphthalene-1,5-dicarbonitrile.
| Compound Name | 3-[2-[4-(N-(4-methoxyphenyl)anilino)phenyl]ethenyl]naphthalene-1,5-dicarbonitrile |
|---|---|
| PubChem CID | 89242616 |
| Molecular Formula | C33H23N3O |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | 3-[2-[4-(N-(4-methoxyphenyl)anilino)phenyl]ethenyl]naphthalene-1,5-dicarbonitrile |
| SMILES | COc1ccc(N(c2ccccc2)c2ccc(C=Cc3cc(C#N)c4cccc(C#N)c4c3)cc2)cc1 |
| InChI | InChI=1S/C33H23N3O/c1-37-31-18-16-30(17-19-31)36(28-7-3-2-4-8-28)29-14-12-24(13-15-29)10-11-25-20-27(23-35)32-9-5-6-26(22-34)33(32)21-25/h2-21H,1H3 |
| InChIKey | ZJOFSECWRZGYNE-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 60.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|