About 2-hydroxynaphthalene-1,4-dicarbonitrile
2-hydroxynaphthalene-1,4-dicarbonitrile (PubChem CID 70018518) has the molecular formula C12H6N2O
and a molecular weight of 194.19 g/mol. Its IUPAC name is 2-hydroxynaphthalene-1,4-dicarbonitrile.
Molecular Properties
| Compound Name | 2-hydroxynaphthalene-1,4-dicarbonitrile |
| PubChem CID | 70018518 |
| Molecular Formula | C12H6N2O |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | 2-hydroxynaphthalene-1,4-dicarbonitrile |
| SMILES | N#Cc1cc(O)c(C#N)c2ccccc12 |
| InChI | InChI=1S/C12H6N2O/c13-6-8-5-12(15)11(7-14)10-4-2-1-3-9(8)10/h1-5,15H |
| InChIKey | ASQYNGBFUNESBE-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 67.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-hydroxynaphthalene-1,4-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxynaphthalene-1,4-dicarbonitrile?
The IUPAC name of 2-hydroxynaphthalene-1,4-dicarbonitrile (CID 70018518) is 2-hydroxynaphthalene-1,4-dicarbonitrile.
What is the SMILES notation for 2-hydroxynaphthalene-1,4-dicarbonitrile?
The canonical SMILES for 2-hydroxynaphthalene-1,4-dicarbonitrile is N#Cc1cc(O)c(C#N)c2ccccc12.
What is the InChIKey of 2-hydroxynaphthalene-1,4-dicarbonitrile?
The InChIKey is ASQYNGBFUNESBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6N2O/c13-6-8-5-12(15)11(7-14)10-4-2-1-3-9(8)10/h1-5,15H.
What are the key properties of 2-hydroxynaphthalene-1,4-dicarbonitrile?
2-hydroxynaphthalene-1,4-dicarbonitrile has a molecular weight of 194.19 g/mol, XLogP of 2.29, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxynaphthalene-1,4-dicarbonitrile is sourced from PubChem (CID 70018518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).