C14H3Cl5N2O — CID 135378944
3,4,6-trichloro-5-(2,6-dichlorophenoxy)benzene-1,2-dicarbonitrile (PubChem CID 135378944) has the molecular formula C14H3Cl5N2O and a molecular weight of 392.46 g/mol. Its IUPAC name is 3,4,6-trichloro-5-(2,6-dichlorophenoxy)benzene-1,2-dicarbonitrile.
| Compound Name | 3,4,6-trichloro-5-(2,6-dichlorophenoxy)benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 135378944 |
| Molecular Formula | C14H3Cl5N2O |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 389.87 |
| IUPAC Name | 3,4,6-trichloro-5-(2,6-dichlorophenoxy)benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1c(Cl)c(Cl)c(Oc2c(Cl)cccc2Cl)c(Cl)c1C#N |
| InChI | InChI=1S/C14H3Cl5N2O/c15-8-2-1-3-9(16)13(8)22-14-11(18)7(5-21)6(4-20)10(17)12(14)19/h1-3H |
| InChIKey | BZFKWMBKDZKMNE-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|