C13H11Cl3N2O — CID 118496523
3,4,6-trichloro-5-pentoxybenzene-1,2-dicarbonitrile (PubChem CID 118496523) has the molecular formula C13H11Cl3N2O and a molecular weight of 317.60 g/mol. Its IUPAC name is 3,4,6-trichloro-5-pentoxybenzene-1,2-dicarbonitrile.
| Compound Name | 3,4,6-trichloro-5-pentoxybenzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 118496523 |
| Molecular Formula | C13H11Cl3N2O |
| Molecular Weight | 317.60 g/mol |
| Exact Mass | 315.99 |
| IUPAC Name | 3,4,6-trichloro-5-pentoxybenzene-1,2-dicarbonitrile |
| SMILES | CCCCCOc1c(Cl)c(Cl)c(C#N)c(C#N)c1Cl |
| InChI | InChI=1S/C13H11Cl3N2O/c1-2-3-4-5-19-13-11(15)9(7-18)8(6-17)10(14)12(13)16/h2-5H2,1H3 |
| InChIKey | YKXPBKVLKKZZBY-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.60 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|