C32H32Cl4N2O2 — CID 135071914
4,5-bis(3,5-dichlorophenyl)-3,6-dihexoxybenzene-1,2-dicarbonitrile (PubChem CID 135071914) has the molecular formula C32H32Cl4N2O2 and a molecular weight of 618.43 g/mol. Its IUPAC name is 4,5-bis(3,5-dichlorophenyl)-3,6-dihexoxybenzene-1,2-dicarbonitrile.
| Compound Name | 4,5-bis(3,5-dichlorophenyl)-3,6-dihexoxybenzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 135071914 |
| Molecular Formula | C32H32Cl4N2O2 |
| Molecular Weight | 618.43 g/mol |
| Exact Mass | 616.12 |
| IUPAC Name | 4,5-bis(3,5-dichlorophenyl)-3,6-dihexoxybenzene-1,2-dicarbonitrile |
| SMILES | CCCCCCOc1c(C#N)c(C#N)c(OCCCCCC)c(-c2cc(Cl)cc(Cl)c2)c1-c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C32H32Cl4N2O2/c1-3-5-7-9-11-39-31-27(19-37)28(20-38)32(40-12-10-8-6-4-2)30(22-15-25(35)18-26(36)16-22)29(31)21-13-23(33)17-24(34)14-21/h13-18H,3-12H2,1-2H3 |
| InChIKey | WHKIYAWUBJJEOK-UHFFFAOYSA-N |
| XLogP | 11.30 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.43 |
| LogP ≤ 5 | 11.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|