C15H23Cl2NO — CID 43515702
1-(3,5-dichloro-2-heptoxyphenyl)-N-methylmethanamine (PubChem CID 43515702) has the molecular formula C15H23Cl2NO and a molecular weight of 304.26 g/mol. Its IUPAC name is 1-(3,5-dichloro-2-heptoxyphenyl)-N-methylmethanamine.
| Compound Name | 1-(3,5-dichloro-2-heptoxyphenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 43515702 |
| Molecular Formula | C15H23Cl2NO |
| Molecular Weight | 304.26 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 1-(3,5-dichloro-2-heptoxyphenyl)-N-methylmethanamine |
| SMILES | CCCCCCCOc1c(Cl)cc(Cl)cc1CNC |
| InChI | InChI=1S/C15H23Cl2NO/c1-3-4-5-6-7-8-19-15-12(11-18-2)9-13(16)10-14(15)17/h9-10,18H,3-8,11H2,1-2H3 |
| InChIKey | GVPLIZZULWUFIW-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.26 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|