C16H25Cl2NO — CID 4717568
N-[(3,5-dichloro-2-ethoxyphenyl)methyl]heptan-1-amine (PubChem CID 4717568) has the molecular formula C16H25Cl2NO and a molecular weight of 318.29 g/mol. Its IUPAC name is N-[(3,5-dichloro-2-ethoxyphenyl)methyl]heptan-1-amine.
| Compound Name | N-[(3,5-dichloro-2-ethoxyphenyl)methyl]heptan-1-amine |
|---|---|
| PubChem CID | 4717568 |
| Molecular Formula | C16H25Cl2NO |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | N-[(3,5-dichloro-2-ethoxyphenyl)methyl]heptan-1-amine |
| SMILES | CCCCCCCNCc1cc(Cl)cc(Cl)c1OCC |
| InChI | InChI=1S/C16H25Cl2NO/c1-3-5-6-7-8-9-19-12-13-10-14(17)11-15(18)16(13)20-4-2/h10-11,19H,3-9,12H2,1-2H3 |
| InChIKey | FTVKPOPXWQPCKS-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|