C17H27Cl2N — CID 20562210
N-[(2,4-dichlorophenyl)methyl]decan-1-amine (PubChem CID 20562210) has the molecular formula C17H27Cl2N and a molecular weight of 316.32 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methyl]decan-1-amine.
| Compound Name | N-[(2,4-dichlorophenyl)methyl]decan-1-amine |
|---|---|
| PubChem CID | 20562210 |
| Molecular Formula | C17H27Cl2N |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methyl]decan-1-amine |
| SMILES | CCCCCCCCCCNCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H27Cl2N/c1-2-3-4-5-6-7-8-9-12-20-14-15-10-11-16(18)13-17(15)19/h10-11,13,20H,2-9,12,14H2,1H3 |
| InChIKey | UZKVETGSPVOUPN-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|