C16H23Cl2NO4 — CID 163328902
N-[(2,4-dichlorophenyl)methyl]heptan-1-amine;oxalic acid (PubChem CID 163328902) has the molecular formula C16H23Cl2NO4 and a molecular weight of 364.27 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methyl]heptan-1-amine;oxalic acid.
| Compound Name | N-[(2,4-dichlorophenyl)methyl]heptan-1-amine;oxalic acid |
|---|---|
| PubChem CID | 163328902 |
| Molecular Formula | C16H23Cl2NO4 |
| Molecular Weight | 364.27 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methyl]heptan-1-amine;oxalic acid |
| SMILES | CCCCCCCNCc1ccc(Cl)cc1Cl.O=C(O)C(=O)O |
| InChI | InChI=1S/C14H21Cl2N.C2H2O4/c1-2-3-4-5-6-9-17-11-12-7-8-13(15)10-14(12)16;3-1(4)2(5)6/h7-8,10,17H,2-6,9,11H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | QAMDTWFXKFELBM-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.27 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|