C10H12Cl2FN — CID 115733095
N-[(2,4-dichlorophenyl)methyl]-3-fluoropropan-1-amine (PubChem CID 115733095) has the molecular formula C10H12Cl2FN and a molecular weight of 236.12 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methyl]-3-fluoropropan-1-amine.
| Compound Name | N-[(2,4-dichlorophenyl)methyl]-3-fluoropropan-1-amine |
|---|---|
| PubChem CID | 115733095 |
| Molecular Formula | C10H12Cl2FN |
| Molecular Weight | 236.12 g/mol |
| Exact Mass | 235.03 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methyl]-3-fluoropropan-1-amine |
| SMILES | FCCCNCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H12Cl2FN/c11-9-3-2-8(10(12)6-9)7-14-5-1-4-13/h2-3,6,14H,1,4-5,7H2 |
| InChIKey | DZXLGBUYLDHOQA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.12 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|