C11H15ClFN3O — CID 114267018
3-chloro-4-[(3-fluoropropylamino)methyl]-N'-hydroxybenzenecarboximidamide (PubChem CID 114267018) has the molecular formula C11H15ClFN3O and a molecular weight of 259.71 g/mol. Its IUPAC name is 3-chloro-4-[(3-fluoropropylamino)methyl]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 3-chloro-4-[(3-fluoropropylamino)methyl]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 114267018 |
| Molecular Formula | C11H15ClFN3O |
| Molecular Weight | 259.71 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 3-chloro-4-[(3-fluoropropylamino)methyl]-N'-hydroxybenzenecarboximidamide |
| SMILES | N/C(=N/O)c1ccc(CNCCCF)c(Cl)c1 |
| InChI | InChI=1S/C11H15ClFN3O/c12-10-6-8(11(14)16-17)2-3-9(10)7-15-5-1-4-13/h2-3,6,15,17H,1,4-5,7H2,(H2,14,16) |
| InChIKey | YQVBQVLKDOMYFJ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.71 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|