C11H14ClN3O — CID 102666967
3-chloro-N'-hydroxy-4-[(prop-2-enylamino)methyl]benzenecarboximidamide (PubChem CID 102666967) has the molecular formula C11H14ClN3O and a molecular weight of 239.71 g/mol. Its IUPAC name is 3-chloro-N'-hydroxy-4-[(prop-2-enylamino)methyl]benzenecarboximidamide.
| Compound Name | 3-chloro-N'-hydroxy-4-[(prop-2-enylamino)methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 102666967 |
| Molecular Formula | C11H14ClN3O |
| Molecular Weight | 239.71 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 3-chloro-N'-hydroxy-4-[(prop-2-enylamino)methyl]benzenecarboximidamide |
| SMILES | C=CCNCc1ccc(/C(N)=N\O)cc1Cl |
| InChI | InChI=1S/C11H14ClN3O/c1-2-5-14-7-9-4-3-8(6-10(9)12)11(13)15-16/h2-4,6,14,16H,1,5,7H2,(H2,13,15) |
| InChIKey | KRULOMIATQWTMK-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.71 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|