C14H22ClN3O — CID 106329343
3-chloro-N'-hydroxy-4-[(3-methylpentan-3-ylamino)methyl]benzenecarboximidamide (PubChem CID 106329343) has the molecular formula C14H22ClN3O and a molecular weight of 283.80 g/mol. Its IUPAC name is 3-chloro-N'-hydroxy-4-[(3-methylpentan-3-ylamino)methyl]benzenecarboximidamide.
| Compound Name | 3-chloro-N'-hydroxy-4-[(3-methylpentan-3-ylamino)methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 106329343 |
| Molecular Formula | C14H22ClN3O |
| Molecular Weight | 283.80 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 3-chloro-N'-hydroxy-4-[(3-methylpentan-3-ylamino)methyl]benzenecarboximidamide |
| SMILES | CCC(C)(CC)NCc1ccc(/C(N)=N/O)cc1Cl |
| InChI | InChI=1S/C14H22ClN3O/c1-4-14(3,5-2)17-9-11-7-6-10(8-12(11)15)13(16)18-19/h6-8,17,19H,4-5,9H2,1-3H3,(H2,16,18) |
| InChIKey | FKHKXKXPXHSWGG-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.80 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|