C14H23ClN4O2 — CID 106148684
3-chloro-4-[[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]amino]methyl]-N'-hydroxybenzenecarboximidamide (PubChem CID 106148684) has the molecular formula C14H23ClN4O2 and a molecular weight of 314.82 g/mol. Its IUPAC name is 3-chloro-4-[[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]amino]methyl]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 3-chloro-4-[[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]amino]methyl]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 106148684 |
| Molecular Formula | C14H23ClN4O2 |
| Molecular Weight | 314.82 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 3-chloro-4-[[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]amino]methyl]-N'-hydroxybenzenecarboximidamide |
| SMILES | CN(C)CC(C)(O)CNCc1ccc(/C(N)=N/O)cc1Cl |
| InChI | InChI=1S/C14H23ClN4O2/c1-14(20,9-19(2)3)8-17-7-11-5-4-10(6-12(11)15)13(16)18-21/h4-6,17,20-21H,7-9H2,1-3H3,(H2,16,18) |
| InChIKey | BHNCCGUKACGRHC-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.82 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|