C24H24N2O2 — CID 118040405
1,4-dibutoxyanthracene-2,3-dicarbonitrile (PubChem CID 118040405) has the molecular formula C24H24N2O2 and a molecular weight of 372.47 g/mol. Its IUPAC name is 1,4-dibutoxyanthracene-2,3-dicarbonitrile.
| Compound Name | 1,4-dibutoxyanthracene-2,3-dicarbonitrile |
|---|---|
| PubChem CID | 118040405 |
| Molecular Formula | C24H24N2O2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 1,4-dibutoxyanthracene-2,3-dicarbonitrile |
| SMILES | CCCCOc1c(C#N)c(C#N)c(OCCCC)c2cc3ccccc3cc12 |
| InChI | InChI=1S/C24H24N2O2/c1-3-5-11-27-23-19-13-17-9-7-8-10-18(17)14-20(19)24(28-12-6-4-2)22(16-26)21(23)15-25/h7-10,13-14H,3-6,11-12H2,1-2H3 |
| InChIKey | YAHDQFBWNCNCFH-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|