C26H26N4O2S2 — CID 177497753
3,6-dibutoxy-4,5-bis(pyridin-2-ylsulfanyl)benzene-1,2-dicarbonitrile (PubChem CID 177497753) has the molecular formula C26H26N4O2S2 and a molecular weight of 490.65 g/mol. Its IUPAC name is 3,6-dibutoxy-4,5-bis(pyridin-2-ylsulfanyl)benzene-1,2-dicarbonitrile.
| Compound Name | 3,6-dibutoxy-4,5-bis(pyridin-2-ylsulfanyl)benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 177497753 |
| Molecular Formula | C26H26N4O2S2 |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | 3,6-dibutoxy-4,5-bis(pyridin-2-ylsulfanyl)benzene-1,2-dicarbonitrile |
| SMILES | CCCCOc1c(C#N)c(C#N)c(OCCCC)c(Sc2ccccn2)c1Sc1ccccn1 |
| InChI | InChI=1S/C26H26N4O2S2/c1-3-5-15-31-23-19(17-27)20(18-28)24(32-16-6-4-2)26(34-22-12-8-10-14-30-22)25(23)33-21-11-7-9-13-29-21/h7-14H,3-6,15-16H2,1-2H3 |
| InChIKey | UUIXLTWSUBMPNI-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 91.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|