C30H34N4O4 — CID 150582810
3,6-dihexoxy-4,5-dipyridin-3-yloxybenzene-1,2-dicarbonitrile (PubChem CID 150582810) has the molecular formula C30H34N4O4 and a molecular weight of 514.63 g/mol. Its IUPAC name is 3,6-dihexoxy-4,5-dipyridin-3-yloxybenzene-1,2-dicarbonitrile.
| Compound Name | 3,6-dihexoxy-4,5-dipyridin-3-yloxybenzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 150582810 |
| Molecular Formula | C30H34N4O4 |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.26 |
| IUPAC Name | 3,6-dihexoxy-4,5-dipyridin-3-yloxybenzene-1,2-dicarbonitrile |
| SMILES | CCCCCCOc1c(C#N)c(C#N)c(OCCCCCC)c(Oc2cccnc2)c1Oc1cccnc1 |
| InChI | InChI=1S/C30H34N4O4/c1-3-5-7-9-17-35-27-25(19-31)26(20-32)28(36-18-10-8-6-4-2)30(38-24-14-12-16-34-22-24)29(27)37-23-13-11-15-33-21-23/h11-16,21-22H,3-10,17-18H2,1-2H3 |
| InChIKey | IOESWTDQZZGQSI-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 110.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|