C14H14N4O — CID 75539617
5,6-diethyl-3-pyridin-3-yloxypyridazine-4-carbonitrile (PubChem CID 75539617) has the molecular formula C14H14N4O and a molecular weight of 254.29 g/mol. Its IUPAC name is 5,6-diethyl-3-pyridin-3-yloxypyridazine-4-carbonitrile.
| Compound Name | 5,6-diethyl-3-pyridin-3-yloxypyridazine-4-carbonitrile |
|---|---|
| PubChem CID | 75539617 |
| Molecular Formula | C14H14N4O |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 5,6-diethyl-3-pyridin-3-yloxypyridazine-4-carbonitrile |
| SMILES | CCc1nnc(Oc2cccnc2)c(C#N)c1CC |
| InChI | InChI=1S/C14H14N4O/c1-3-11-12(8-15)14(18-17-13(11)4-2)19-10-6-5-7-16-9-10/h5-7,9H,3-4H2,1-2H3 |
| InChIKey | ZTORKIVYPZHTIV-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 71.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |