C14H21N3O2 — CID 80510168
5,6-diethyl-3-(2-propan-2-yloxyethoxy)pyridazine-4-carbonitrile (PubChem CID 80510168) has the molecular formula C14H21N3O2 and a molecular weight of 263.34 g/mol. Its IUPAC name is 5,6-diethyl-3-(2-propan-2-yloxyethoxy)pyridazine-4-carbonitrile.
| Compound Name | 5,6-diethyl-3-(2-propan-2-yloxyethoxy)pyridazine-4-carbonitrile |
|---|---|
| PubChem CID | 80510168 |
| Molecular Formula | C14H21N3O2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | 5,6-diethyl-3-(2-propan-2-yloxyethoxy)pyridazine-4-carbonitrile |
| SMILES | CCc1nnc(OCCOC(C)C)c(C#N)c1CC |
| InChI | InChI=1S/C14H21N3O2/c1-5-11-12(9-15)14(17-16-13(11)6-2)19-8-7-18-10(3)4/h10H,5-8H2,1-4H3 |
| InChIKey | DWRRUJBGBYBIFS-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 68.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|